3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid

C16H32O6 — CID 135368703

IUPAC3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid
SMILESCC(C)C(=O)O.CCC(=O)O.CCCC(=O)OCCC(C)C
InChIInChI=1S/C9H18O2.C4H8O2.C3H6O2/c1-4-5-9(10)11-7-6-8(2)3;1-3(2)4(5)6;1-2-3(4)5/h8H,4-7H2,1-3H3;3H,1-2H3,(H,5,6);2H2,1H3,(H,4,5)
InChIKeyMJSDBIPROBZFFH-UHFFFAOYSA-N
MW320.43 g/mol
LogP3.58
Rot. Bonds7

About 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid

3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid (PubChem CID 135368703) has the molecular formula C16H32O6 and a molecular weight of 320.43 g/mol. Its IUPAC name is 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid.

Molecular Properties

Compound Name3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid
PubChem CID135368703
Molecular FormulaC16H32O6
Molecular Weight320.43 g/mol
Exact Mass320.22
IUPAC Name3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid
SMILESCC(C)C(=O)O.CCC(=O)O.CCCC(=O)OCCC(C)C
InChIInChI=1S/C9H18O2.C4H8O2.C3H6O2/c1-4-5-9(10)11-7-6-8(2)3;1-3(2)4(5)6;1-2-3(4)5/h8H,4-7H2,1-3H3;3H,1-2H3,(H,5,6);2H2,1H3,(H,4,5)
InChIKeyMJSDBIPROBZFFH-UHFFFAOYSA-N
XLogP3.58
TPSA100.90 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.43
LogP ≤ 53.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid?
The IUPAC name of 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid (CID 135368703) is 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid.
What is the SMILES notation for 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid?
The canonical SMILES for 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid is CC(C)C(=O)O.CCC(=O)O.CCCC(=O)OCCC(C)C.
What is the InChIKey of 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid?
The InChIKey is MJSDBIPROBZFFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2.C4H8O2.C3H6O2/c1-4-5-9(10)11-7-6-8(2)3;1-3(2)4(5)6;1-2-3(4)5/h8H,4-7H2,1-3H3;3H,1-2H3,(H,5,6);2H2,1H3,(H,4,5).
What are the key properties of 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid?
3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid has a molecular weight of 320.43 g/mol, XLogP of 3.58, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl butanoate;2-methylpropanoic acid;propanoic acid is sourced from PubChem (CID 135368703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).