C40H80O6 — CID 158483682
decanoic acid;2-(3-methylbutyl)dodecanoic acid;3-methylbutyl octanoate (PubChem CID 158483682) has the molecular formula C40H80O6 and a molecular weight of 657.07 g/mol. Its IUPAC name is decanoic acid;2-(3-methylbutyl)dodecanoic acid;3-methylbutyl octanoate.
| Compound Name | decanoic acid;2-(3-methylbutyl)dodecanoic acid;3-methylbutyl octanoate |
|---|---|
| PubChem CID | 158483682 |
| Molecular Formula | C40H80O6 |
| Molecular Weight | 657.07 g/mol |
| Exact Mass | 656.60 |
| IUPAC Name | decanoic acid;2-(3-methylbutyl)dodecanoic acid;3-methylbutyl octanoate |
| SMILES | CCCCCCCC(=O)OCCC(C)C.CCCCCCCCCC(=O)O.CCCCCCCCCCC(CCC(C)C)C(=O)O |
| InChI | InChI=1S/C17H34O2.C13H26O2.C10H20O2/c1-4-5-6-7-8-9-10-11-12-16(17(18)19)14-13-15(2)3;1-4-5-6-7-8-9-13(14)15-11-10-12(2)3;1-2-3-4-5-6-7-8-9-10(11)12/h15-16H,4-14H2,1-3H3,(H,18,19);12H,4-11H2,1-3H3;2-9H2,1H3,(H,11,12) |
| InChIKey | HHVCUWIUXKARCK-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.07 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|