C23H27N2O4S- — CID 135368888
(3aS,6aR)-5-benzyl-5-hydroxy-2-[2-oxo-2-[4-[(sulfinatoamino)methyl]phenyl]ethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 135368888) has the molecular formula C23H27N2O4S- and a molecular weight of 427.55 g/mol. Its IUPAC name is (3aS,6aR)-5-benzyl-5-hydroxy-2-[2-oxo-2-[4-[(sulfinatoamino)methyl]phenyl]ethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-5-benzyl-5-hydroxy-2-[2-oxo-2-[4-[(sulfinatoamino)methyl]phenyl]ethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 135368888 |
| Molecular Formula | C23H27N2O4S- |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (3aS,6aR)-5-benzyl-5-hydroxy-2-[2-oxo-2-[4-[(sulfinatoamino)methyl]phenyl]ethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | O=C(CN1C[C@@H]2CC(O)(Cc3ccccc3)C[C@@H]2C1)c1ccc(CNS(=O)[O-])cc1 |
| InChI | InChI=1S/C23H28N2O4S/c26-22(19-8-6-18(7-9-19)13-24-30(28)29)16-25-14-20-11-23(27,12-21(20)15-25)10-17-4-2-1-3-5-17/h1-9,20-21,24,27H,10-16H2,(H,28,29)/p-1/t20-,21+,23? |
| InChIKey | GEEPCCYUKRANRP-TYABSZSSSA-M |
| XLogP | 2.07 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|