C17H20BrFN2O4 — CID 135369522
methyl 2-amino-4-bromo-5-fluoro-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]benzoate (PubChem CID 135369522) has the molecular formula C17H20BrFN2O4 and a molecular weight of 415.26 g/mol. Its IUPAC name is methyl 2-amino-4-bromo-5-fluoro-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]benzoate.
| Compound Name | methyl 2-amino-4-bromo-5-fluoro-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]benzoate |
|---|---|
| PubChem CID | 135369522 |
| Molecular Formula | C17H20BrFN2O4 |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | methyl 2-amino-4-bromo-5-fluoro-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ynyl]benzoate |
| SMILES | COC(=O)c1cc(F)c(Br)c(C#CC(C)NC(=O)OC(C)(C)C)c1N |
| InChI | InChI=1S/C17H20BrFN2O4/c1-9(21-16(23)25-17(2,3)4)6-7-10-13(18)12(19)8-11(14(10)20)15(22)24-5/h8-9H,20H2,1-5H3,(H,21,23) |
| InChIKey | SCMNGWDXKJIVFQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|