C16H21BrN2O6S — CID 175595965
(2R)-3-(2-amino-5-bromo-4-methoxycarbonylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoic acid (PubChem CID 175595965) has the molecular formula C16H21BrN2O6S and a molecular weight of 449.32 g/mol. Its IUPAC name is (2R)-3-(2-amino-5-bromo-4-methoxycarbonylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-3-(2-amino-5-bromo-4-methoxycarbonylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175595965 |
| Molecular Formula | C16H21BrN2O6S |
| Molecular Weight | 449.32 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | (2R)-3-(2-amino-5-bromo-4-methoxycarbonylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoic acid |
| SMILES | COC(=O)c1cc(N)c(C(S)[C@H](NC(=O)OC(C)(C)C)C(=O)O)cc1Br |
| InChI | InChI=1S/C16H21BrN2O6S/c1-16(2,3)25-15(23)19-11(13(20)21)12(26)8-5-9(17)7(6-10(8)18)14(22)24-4/h5-6,11-12,26H,18H2,1-4H3,(H,19,23)(H,20,21)/t11-,12?/m0/s1 |
| InChIKey | CWMUETOAXAPNOX-PXYINDEMSA-N |
| XLogP | 2.77 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|