C15H16ClN3O3 — CID 135371295
[2-(2-chlorophenyl)-2-oxoethyl] 5-amino-1-ethyl-3-methylpyrazole-4-carboxylate (PubChem CID 135371295) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-2-oxoethyl] 5-amino-1-ethyl-3-methylpyrazole-4-carboxylate.
| Compound Name | [2-(2-chlorophenyl)-2-oxoethyl] 5-amino-1-ethyl-3-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 135371295 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | [2-(2-chlorophenyl)-2-oxoethyl] 5-amino-1-ethyl-3-methylpyrazole-4-carboxylate |
| SMILES | CCn1nc(C)c(C(=O)OCC(=O)c2ccccc2Cl)c1N |
| InChI | InChI=1S/C15H16ClN3O3/c1-3-19-14(17)13(9(2)18-19)15(21)22-8-12(20)10-6-4-5-7-11(10)16/h4-7H,3,8,17H2,1-2H3 |
| InChIKey | RQLHFZBJRTYLCY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |