C14H12ClN3O5 — CID 153408781
[2-(2-chlorophenyl)-2-oxoethyl] 1,3-dimethyl-4-nitropyrazole-5-carboxylate (PubChem CID 153408781) has the molecular formula C14H12ClN3O5 and a molecular weight of 337.72 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-2-oxoethyl] 1,3-dimethyl-4-nitropyrazole-5-carboxylate.
| Compound Name | [2-(2-chlorophenyl)-2-oxoethyl] 1,3-dimethyl-4-nitropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 153408781 |
| Molecular Formula | C14H12ClN3O5 |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | [2-(2-chlorophenyl)-2-oxoethyl] 1,3-dimethyl-4-nitropyrazole-5-carboxylate |
| SMILES | Cc1nn(C)c(C(=O)OCC(=O)c2ccccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12ClN3O5/c1-8-12(18(21)22)13(17(2)16-8)14(20)23-7-11(19)9-5-3-4-6-10(9)15/h3-6H,7H2,1-2H3 |
| InChIKey | VYZNUTGMTLXCQU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|