C19H24N10O4 — CID 135373122
methyl 3-[2-[[2-[4-(5-azidopyrimidin-2-yl)piperazin-1-yl]pyrimidine-5-carbonyl]amino]ethoxy]propanoate (PubChem CID 135373122) has the molecular formula C19H24N10O4 and a molecular weight of 456.47 g/mol. Its IUPAC name is methyl 3-[2-[[2-[4-(5-azidopyrimidin-2-yl)piperazin-1-yl]pyrimidine-5-carbonyl]amino]ethoxy]propanoate.
| Compound Name | methyl 3-[2-[[2-[4-(5-azidopyrimidin-2-yl)piperazin-1-yl]pyrimidine-5-carbonyl]amino]ethoxy]propanoate |
|---|---|
| PubChem CID | 135373122 |
| Molecular Formula | C19H24N10O4 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | methyl 3-[2-[[2-[4-(5-azidopyrimidin-2-yl)piperazin-1-yl]pyrimidine-5-carbonyl]amino]ethoxy]propanoate |
| SMILES | COC(=O)CCOCCNC(=O)c1cnc(N2CCN(c3ncc(N=[N+]=[N-])cn3)CC2)nc1 |
| InChI | InChI=1S/C19H24N10O4/c1-32-16(30)2-8-33-9-3-21-17(31)14-10-22-18(23-11-14)28-4-6-29(7-5-28)19-24-12-15(13-25-19)26-27-20/h10-13H,2-9H2,1H3,(H,21,31) |
| InChIKey | RWTDBEHZNXANIV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 171.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|