C25H31N7O5 — CID 172540558
2-(3-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-N-[2-[3-(methylamino)-3-oxopropoxy]ethyl]pyrimidine-5-carboxamide (PubChem CID 172540558) has the molecular formula C25H31N7O5 and a molecular weight of 509.57 g/mol. Its IUPAC name is 2-(3-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-N-[2-[3-(methylamino)-3-oxopropoxy]ethyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(3-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-N-[2-[3-(methylamino)-3-oxopropoxy]ethyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 172540558 |
| Molecular Formula | C25H31N7O5 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 2-(3-benzyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-N-[2-[3-(methylamino)-3-oxopropoxy]ethyl]pyrimidine-5-carboxamide |
| SMILES | CNC(=O)CCOCCNC(=O)c1cnc(N2CCC3(CC2)NC(=O)N(Cc2ccccc2)C3=O)nc1 |
| InChI | InChI=1S/C25H31N7O5/c1-26-20(33)7-13-37-14-10-27-21(34)19-15-28-23(29-16-19)31-11-8-25(9-12-31)22(35)32(24(36)30-25)17-18-5-3-2-4-6-18/h2-6,15-16H,7-14,17H2,1H3,(H,26,33)(H,27,34)(H,30,36) |
| InChIKey | JCZLBOLZRKCMLM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|