C18H24N8O3 — CID 142467636
2-[4-(5-aminopyrimidin-2-yl)piperazin-1-yl]-N-[2-(3-oxopropoxy)ethyl]pyrimidine-5-carboxamide (PubChem CID 142467636) has the molecular formula C18H24N8O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[4-(5-aminopyrimidin-2-yl)piperazin-1-yl]-N-[2-(3-oxopropoxy)ethyl]pyrimidine-5-carboxamide.
| Compound Name | 2-[4-(5-aminopyrimidin-2-yl)piperazin-1-yl]-N-[2-(3-oxopropoxy)ethyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142467636 |
| Molecular Formula | C18H24N8O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-[4-(5-aminopyrimidin-2-yl)piperazin-1-yl]-N-[2-(3-oxopropoxy)ethyl]pyrimidine-5-carboxamide |
| SMILES | Nc1cnc(N2CCN(c3ncc(C(=O)NCCOCCC=O)cn3)CC2)nc1 |
| InChI | InChI=1S/C18H24N8O3/c19-15-12-23-18(24-13-15)26-5-3-25(4-6-26)17-21-10-14(11-22-17)16(28)20-2-9-29-8-1-7-27/h7,10-13H,1-6,8-9,19H2,(H,20,28) |
| InChIKey | ANDNTCKWSZBQJK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|