About ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal
ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal (PubChem CID 153358534) has the molecular formula C18H32N4O5
and a molecular weight of 384.48 g/mol. Its IUPAC name is ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal.
Molecular Properties
| Compound Name | ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal |
| PubChem CID | 153358534 |
| Molecular Formula | C18H32N4O5 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal |
| SMILES | CCOC=O.CO.Cc1cnc(N2CCN(CCOCCC=O)CC2)nc1 |
| InChI | InChI=1S/C14H22N4O2.C3H6O2.CH4O/c1-13-11-15-14(16-12-13)18-5-3-17(4-6-18)7-10-20-9-2-8-19;1-2-5-3-4;1-2/h8,11-12H,2-7,9-10H2,1H3;3H,2H2,1H3;2H,1H3 |
| InChIKey | SZGZVGRIMFEDSB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal?
The IUPAC name of ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal (CID 153358534) is ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal.
What is the SMILES notation for ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal?
The canonical SMILES for ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal is CCOC=O.CO.Cc1cnc(N2CCN(CCOCCC=O)CC2)nc1.
What is the InChIKey of ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal?
The InChIKey is SZGZVGRIMFEDSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O2.C3H6O2.CH4O/c1-13-11-15-14(16-12-13)18-5-3-17(4-6-18)7-10-20-9-2-8-19;1-2-5-3-4;1-2/h8,11-12H,2-7,9-10H2,1H3;3H,2H2,1H3;2H,1H3.
What are the key properties of ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal?
ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal has a molecular weight of 384.48 g/mol, XLogP of 0.30, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;methanol;3-[2-[4-(5-methylpyrimidin-2-yl)piperazin-1-yl]ethoxy]propanal is sourced from PubChem (CID 153358534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).