C9H14N2O — CID 135373465
(1R,3R,8S)-6,9-diazatricyclo[4.3.1.03,8]decane-9-carbaldehyde (PubChem CID 135373465) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (1R,3R,8S)-6,9-diazatricyclo[4.3.1.03,8]decane-9-carbaldehyde.
| Compound Name | (1R,3R,8S)-6,9-diazatricyclo[4.3.1.03,8]decane-9-carbaldehyde |
|---|---|
| PubChem CID | 135373465 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (1R,3R,8S)-6,9-diazatricyclo[4.3.1.03,8]decane-9-carbaldehyde |
| SMILES | O=CN1[C@@H]2C[C@H]3CCN(C2)C[C@H]31 |
| InChI | InChI=1S/C9H14N2O/c12-6-11-8-3-7-1-2-10(4-8)5-9(7)11/h6-9H,1-5H2/t7-,8-,9-/m1/s1 |
| InChIKey | GOGSKINLSXHYAN-IWSPIJDZSA-N |
| XLogP | -0.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|