C7H11NO — CID 93499420
(3S,4R)-1-azabicyclo[2.2.1]heptane-3-carbaldehyde (PubChem CID 93499420) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (3S,4R)-1-azabicyclo[2.2.1]heptane-3-carbaldehyde.
| Compound Name | (3S,4R)-1-azabicyclo[2.2.1]heptane-3-carbaldehyde |
|---|---|
| PubChem CID | 93499420 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (3S,4R)-1-azabicyclo[2.2.1]heptane-3-carbaldehyde |
| SMILES | O=C[C@@H]1CN2CC[C@H]1C2 |
| InChI | InChI=1S/C7H11NO/c9-5-7-4-8-2-1-6(7)3-8/h5-7H,1-4H2/t6-,7-/m0/s1 |
| InChIKey | KSWRLFRZGARPMG-BQBZGAKWSA-N |
| XLogP | 0.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|