C10H19N — CID 66827257
(3S,4R)-3-tert-butyl-1-azabicyclo[2.2.1]heptane (PubChem CID 66827257) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (3S,4R)-3-tert-butyl-1-azabicyclo[2.2.1]heptane.
| Compound Name | (3S,4R)-3-tert-butyl-1-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 66827257 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (3S,4R)-3-tert-butyl-1-azabicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)[C@H]1CN2CC[C@H]1C2 |
| InChI | InChI=1S/C10H19N/c1-10(2,3)9-7-11-5-4-8(9)6-11/h8-9H,4-7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | JYVVDKGXRSVBRO-IUCAKERBSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |