C25H32N6O3 — CID 135374344
methoxy-[4-[8-methyl-3-[3-(4-methylpiperazin-1-yl)cyclopentyl]imidazo[1,5-a]pyrazin-1-yl]phenyl]carbamic acid (PubChem CID 135374344) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is methoxy-[4-[8-methyl-3-[3-(4-methylpiperazin-1-yl)cyclopentyl]imidazo[1,5-a]pyrazin-1-yl]phenyl]carbamic acid.
| Compound Name | methoxy-[4-[8-methyl-3-[3-(4-methylpiperazin-1-yl)cyclopentyl]imidazo[1,5-a]pyrazin-1-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 135374344 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | methoxy-[4-[8-methyl-3-[3-(4-methylpiperazin-1-yl)cyclopentyl]imidazo[1,5-a]pyrazin-1-yl]phenyl]carbamic acid |
| SMILES | CON(C(=O)O)c1ccc(-c2nc(C3CCC(N4CCN(C)CC4)C3)n3ccnc(C)c23)cc1 |
| InChI | InChI=1S/C25H32N6O3/c1-17-23-22(18-4-7-20(8-5-18)31(34-3)25(32)33)27-24(30(23)11-10-26-17)19-6-9-21(16-19)29-14-12-28(2)13-15-29/h4-5,7-8,10-11,19,21H,6,9,12-16H2,1-3H3,(H,32,33) |
| InChIKey | RHGJIPKRFAFBNY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|