C20H21FN4O4 — CID 135374233
[3-fluoro-4-[8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazin-1-yl]phenyl]-methoxycarbamic acid (PubChem CID 135374233) has the molecular formula C20H21FN4O4 and a molecular weight of 400.41 g/mol. Its IUPAC name is [3-fluoro-4-[8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazin-1-yl]phenyl]-methoxycarbamic acid.
| Compound Name | [3-fluoro-4-[8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazin-1-yl]phenyl]-methoxycarbamic acid |
|---|---|
| PubChem CID | 135374233 |
| Molecular Formula | C20H21FN4O4 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [3-fluoro-4-[8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazin-1-yl]phenyl]-methoxycarbamic acid |
| SMILES | CON(C(=O)O)c1ccc(-c2nc(C3CCOCC3)n3ccnc(C)c23)c(F)c1 |
| InChI | InChI=1S/C20H21FN4O4/c1-12-18-17(15-4-3-14(11-16(15)21)25(28-2)20(26)27)23-19(24(18)8-7-22-12)13-5-9-29-10-6-13/h3-4,7-8,11,13H,5-6,9-10H2,1-2H3,(H,26,27) |
| InChIKey | FUXHIHFAVRWYHU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|