C33H33FN6O3 — CID 140930518
(Z)-1-[(3R)-3-[8-amino-1-(2-fluoro-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]-2-isocyano-3-(4-methyloxan-4-yl)prop-2-en-1-one (PubChem CID 140930518) has the molecular formula C33H33FN6O3 and a molecular weight of 580.66 g/mol. Its IUPAC name is (Z)-1-[(3R)-3-[8-amino-1-(2-fluoro-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]-2-isocyano-3-(4-methyloxan-4-yl)prop-2-en-1-one.
| Compound Name | (Z)-1-[(3R)-3-[8-amino-1-(2-fluoro-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]-2-isocyano-3-(4-methyloxan-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 140930518 |
| Molecular Formula | C33H33FN6O3 |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | (Z)-1-[(3R)-3-[8-amino-1-(2-fluoro-4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]-2-isocyano-3-(4-methyloxan-4-yl)prop-2-en-1-one |
| SMILES | [C-]#[N+]/C(=C\C1(C)CCOCC1)C(=O)N1CCC[C@@H](c2nc(-c3ccc(Oc4ccccc4)cc3F)c3c(N)nccn23)C1 |
| InChI | InChI=1S/C33H33FN6O3/c1-33(12-17-42-18-13-33)20-27(36-2)32(41)39-15-6-7-22(21-39)31-38-28(29-30(35)37-14-16-40(29)31)25-11-10-24(19-26(25)34)43-23-8-4-3-5-9-23/h3-5,8-11,14,16,19-20,22H,6-7,12-13,15,17-18,21H2,1H3,(H2,35,37)/b27-20-/t22-/m1/s1 |
| InChIKey | SWFJRUQYOXAJST-FILJVYHVSA-N |
| XLogP | 6.24 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|