C25H31N5O4 — CID 135374227
methoxy-[4-[8-methyl-3-(4-morpholin-4-ylcyclohexyl)imidazo[1,5-a]pyrazin-1-yl]phenyl]carbamic acid (PubChem CID 135374227) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is methoxy-[4-[8-methyl-3-(4-morpholin-4-ylcyclohexyl)imidazo[1,5-a]pyrazin-1-yl]phenyl]carbamic acid.
| Compound Name | methoxy-[4-[8-methyl-3-(4-morpholin-4-ylcyclohexyl)imidazo[1,5-a]pyrazin-1-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 135374227 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | methoxy-[4-[8-methyl-3-(4-morpholin-4-ylcyclohexyl)imidazo[1,5-a]pyrazin-1-yl]phenyl]carbamic acid |
| SMILES | CON(C(=O)O)c1ccc(-c2nc(C3CCC(N4CCOCC4)CC3)n3ccnc(C)c23)cc1 |
| InChI | InChI=1S/C25H31N5O4/c1-17-23-22(18-3-9-21(10-4-18)30(33-2)25(31)32)27-24(29(23)12-11-26-17)19-5-7-20(8-6-19)28-13-15-34-16-14-28/h3-4,9-12,19-20H,5-8,13-16H2,1-2H3,(H,31,32) |
| InChIKey | HWLXFAAIVCSVMZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|