C14H9ClF4N2O — CID 135376328
5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-(trifluoromethyl)benzoyl chloride (PubChem CID 135376328) has the molecular formula C14H9ClF4N2O and a molecular weight of 332.68 g/mol. Its IUPAC name is 5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-(trifluoromethyl)benzoyl chloride.
| Compound Name | 5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 135376328 |
| Molecular Formula | C14H9ClF4N2O |
| Molecular Weight | 332.68 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-(trifluoromethyl)benzoyl chloride |
| SMILES | O=C(Cl)c1cc(-n2cnc(C3CC3)c2)c(C(F)(F)F)cc1F |
| InChI | InChI=1S/C14H9ClF4N2O/c15-13(22)8-3-12(9(4-10(8)16)14(17,18)19)21-5-11(20-6-21)7-1-2-7/h3-7H,1-2H2 |
| InChIKey | FAAGXZXYYWZFLP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|