C15H14ClFN2O — CID 155049483
5-(4-cyclobutylimidazol-1-yl)-2-fluoro-4-methylbenzoyl chloride (PubChem CID 155049483) has the molecular formula C15H14ClFN2O and a molecular weight of 292.74 g/mol. Its IUPAC name is 5-(4-cyclobutylimidazol-1-yl)-2-fluoro-4-methylbenzoyl chloride.
| Compound Name | 5-(4-cyclobutylimidazol-1-yl)-2-fluoro-4-methylbenzoyl chloride |
|---|---|
| PubChem CID | 155049483 |
| Molecular Formula | C15H14ClFN2O |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5-(4-cyclobutylimidazol-1-yl)-2-fluoro-4-methylbenzoyl chloride |
| SMILES | Cc1cc(F)c(C(=O)Cl)cc1-n1cnc(C2CCC2)c1 |
| InChI | InChI=1S/C15H14ClFN2O/c1-9-5-12(17)11(15(16)20)6-14(9)19-7-13(18-8-19)10-3-2-4-10/h5-8,10H,2-4H2,1H3 |
| InChIKey | OCNLOAFMKWTWOX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|