C20H15ClN2O3 — CID 135376438
1-[3-(1,3-benzodioxol-5-yl)phenyl]-3-(4-chlorophenyl)urea (PubChem CID 135376438) has the molecular formula C20H15ClN2O3 and a molecular weight of 366.80 g/mol. Its IUPAC name is 1-[3-(1,3-benzodioxol-5-yl)phenyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[3-(1,3-benzodioxol-5-yl)phenyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 135376438 |
| Molecular Formula | C20H15ClN2O3 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 1-[3-(1,3-benzodioxol-5-yl)phenyl]-3-(4-chlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cccc(-c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C20H15ClN2O3/c21-15-5-7-16(8-6-15)22-20(24)23-17-3-1-2-13(10-17)14-4-9-18-19(11-14)26-12-25-18/h1-11H,12H2,(H2,22,23,24) |
| InChIKey | HLUHOLJVHDSVRY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |