C16H28O8 — CID 135377568
2,3-dihydroxypropanoyl 2-(2,3-dihydroxypropanoyl)decanoate (PubChem CID 135377568) has the molecular formula C16H28O8 and a molecular weight of 348.39 g/mol. Its IUPAC name is 2,3-dihydroxypropanoyl 2-(2,3-dihydroxypropanoyl)decanoate.
| Compound Name | 2,3-dihydroxypropanoyl 2-(2,3-dihydroxypropanoyl)decanoate |
|---|---|
| PubChem CID | 135377568 |
| Molecular Formula | C16H28O8 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2,3-dihydroxypropanoyl 2-(2,3-dihydroxypropanoyl)decanoate |
| SMILES | CCCCCCCCC(C(=O)OC(=O)C(O)CO)C(=O)C(O)CO |
| InChI | InChI=1S/C16H28O8/c1-2-3-4-5-6-7-8-11(14(21)12(19)9-17)15(22)24-16(23)13(20)10-18/h11-13,17-20H,2-10H2,1H3 |
| InChIKey | VZPCPGFRDGHCPE-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|