C28H52O7 — CID 145194553
2,3-dihydroxypropanoyl 2-hexyl-11-octanoyloxyundecanoate (PubChem CID 145194553) has the molecular formula C28H52O7 and a molecular weight of 500.72 g/mol. Its IUPAC name is 2,3-dihydroxypropanoyl 2-hexyl-11-octanoyloxyundecanoate.
| Compound Name | 2,3-dihydroxypropanoyl 2-hexyl-11-octanoyloxyundecanoate |
|---|---|
| PubChem CID | 145194553 |
| Molecular Formula | C28H52O7 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | 2,3-dihydroxypropanoyl 2-hexyl-11-octanoyloxyundecanoate |
| SMILES | CCCCCCCC(=O)OCCCCCCCCCC(CCCCCC)C(=O)OC(=O)C(O)CO |
| InChI | InChI=1S/C28H52O7/c1-3-5-7-12-17-21-26(31)34-22-18-14-11-9-10-13-16-20-24(19-15-8-6-4-2)27(32)35-28(33)25(30)23-29/h24-25,29-30H,3-23H2,1-2H3 |
| InChIKey | OEXOZIXGVIPQCN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|