C27H32N2O3 — CID 135380004
(1S,4aS,10aR)-6-cyano-N-[(2,4-dimethoxyphenyl)methyl]-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide (PubChem CID 135380004) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is (1S,4aS,10aR)-6-cyano-N-[(2,4-dimethoxyphenyl)methyl]-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide.
| Compound Name | (1S,4aS,10aR)-6-cyano-N-[(2,4-dimethoxyphenyl)methyl]-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 135380004 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (1S,4aS,10aR)-6-cyano-N-[(2,4-dimethoxyphenyl)methyl]-1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@@]2(C)CCC[C@]3(C)c4cc(C#N)ccc4CC[C@@H]23)c(OC)c1 |
| InChI | InChI=1S/C27H32N2O3/c1-26-12-5-13-27(2,24(26)11-9-19-7-6-18(16-28)14-22(19)26)25(30)29-17-20-8-10-21(31-3)15-23(20)32-4/h6-8,10,14-15,24H,5,9,11-13,17H2,1-4H3,(H,29,30)/t24-,26-,27+/m1/s1 |
| InChIKey | DBBPOAKZZQNTKI-IEUSDUHPSA-N |
| XLogP | 4.90 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |