C11H11NO4 — CID 135381962
5-methyl-6-[(E)-2-nitroethenyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 135381962) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 5-methyl-6-[(E)-2-nitroethenyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-methyl-6-[(E)-2-nitroethenyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 135381962 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-methyl-6-[(E)-2-nitroethenyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1c(/C=C/[N+](=O)[O-])ccc2c1OCCO2 |
| InChI | InChI=1S/C11H11NO4/c1-8-9(4-5-12(13)14)2-3-10-11(8)16-7-6-15-10/h2-5H,6-7H2,1H3/b5-4+ |
| InChIKey | CUSDKMXNRBUEMH-SNAWJCMRSA-N |
| XLogP | 2.01 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|