C11H11NO3 — CID 3290864
6-(2-nitroethenyl)-3,4-dihydro-2H-chromene (PubChem CID 3290864) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 6-(2-nitroethenyl)-3,4-dihydro-2H-chromene.
| Compound Name | 6-(2-nitroethenyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 3290864 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 6-(2-nitroethenyl)-3,4-dihydro-2H-chromene |
| SMILES | O=[N+]([O-])C=Cc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C11H11NO3/c13-12(14)6-5-9-3-4-11-10(8-9)2-1-7-15-11/h3-6,8H,1-2,7H2 |
| InChIKey | CNSMZWUDRMEYQP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|