C13H15NO3 — CID 54071203
5-(2-nitropent-1-enyl)-2,3-dihydro-1-benzofuran (PubChem CID 54071203) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-(2-nitropent-1-enyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 5-(2-nitropent-1-enyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 54071203 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 5-(2-nitropent-1-enyl)-2,3-dihydro-1-benzofuran |
| SMILES | CCCC(=Cc1ccc2c(c1)CCO2)[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO3/c1-2-3-12(14(15)16)9-10-4-5-13-11(8-10)6-7-17-13/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | MGOLYGMJIQIYMW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|