C5H12N4 — CID 135382309
2,3,3a,4,5,6,7,7a-octahydro-1H-triazolo[4,5-c]pyridine (PubChem CID 135382309) has the molecular formula C5H12N4 and a molecular weight of 128.18 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-triazolo[4,5-c]pyridine.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-triazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 135382309 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-triazolo[4,5-c]pyridine |
| SMILES | C1CC2NNNC2CN1 |
| InChI | InChI=1S/C5H12N4/c1-2-6-3-5-4(1)7-9-8-5/h4-9H,1-3H2 |
| InChIKey | YVKQPZIRGWDPJP-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |