C21H27FN2O4 — CID 135384894
tert-butyl (4aR,6S)-8-ethynyl-10-fluoro-6-(methoxymethyl)-1,2,4,4a,5,6-hexahydropyrazino[2,1-d][1,5]benzoxazepine-3-carboxylate (PubChem CID 135384894) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is tert-butyl (4aR,6S)-8-ethynyl-10-fluoro-6-(methoxymethyl)-1,2,4,4a,5,6-hexahydropyrazino[2,1-d][1,5]benzoxazepine-3-carboxylate.
| Compound Name | tert-butyl (4aR,6S)-8-ethynyl-10-fluoro-6-(methoxymethyl)-1,2,4,4a,5,6-hexahydropyrazino[2,1-d][1,5]benzoxazepine-3-carboxylate |
|---|---|
| PubChem CID | 135384894 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | tert-butyl (4aR,6S)-8-ethynyl-10-fluoro-6-(methoxymethyl)-1,2,4,4a,5,6-hexahydropyrazino[2,1-d][1,5]benzoxazepine-3-carboxylate |
| SMILES | C#Cc1cc(F)cc2c1O[C@H](COC)C[C@@H]1CN(C(=O)OC(C)(C)C)CCN21 |
| InChI | InChI=1S/C21H27FN2O4/c1-6-14-9-15(22)10-18-19(14)27-17(13-26-5)11-16-12-23(7-8-24(16)18)20(25)28-21(2,3)4/h1,9-10,16-17H,7-8,11-13H2,2-5H3/t16-,17+/m1/s1 |
| InChIKey | CNBJFULTKFRRTA-SJORKVTESA-N |
| XLogP | 3.03 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|