C20H17ClN6O — CID 135385810
6-[(2-chloro-4-pyridinyl)amino]-1-methyl-4-(pyrimidin-2-ylmethylamino)quinolin-2-one (PubChem CID 135385810) has the molecular formula C20H17ClN6O and a molecular weight of 392.85 g/mol. Its IUPAC name is 6-[(2-chloro-4-pyridinyl)amino]-1-methyl-4-(pyrimidin-2-ylmethylamino)quinolin-2-one.
| Compound Name | 6-[(2-chloro-4-pyridinyl)amino]-1-methyl-4-(pyrimidin-2-ylmethylamino)quinolin-2-one |
|---|---|
| PubChem CID | 135385810 |
| Molecular Formula | C20H17ClN6O |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 6-[(2-chloro-4-pyridinyl)amino]-1-methyl-4-(pyrimidin-2-ylmethylamino)quinolin-2-one |
| SMILES | Cn1c(=O)cc(NCc2ncccn2)c2cc(Nc3ccnc(Cl)c3)ccc21 |
| InChI | InChI=1S/C20H17ClN6O/c1-27-17-4-3-13(26-14-5-8-22-18(21)10-14)9-15(17)16(11-20(27)28)25-12-19-23-6-2-7-24-19/h2-11,25H,12H2,1H3,(H,22,26) |
| InChIKey | JPANFGJBZHNDGT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|