C17H13FN2O4S — CID 135385857
5-(benzenesulfonamido)-3-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 135385857) has the molecular formula C17H13FN2O4S and a molecular weight of 360.37 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-3-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 5-(benzenesulfonamido)-3-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 135385857 |
| Molecular Formula | C17H13FN2O4S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 5-(benzenesulfonamido)-3-(4-fluorophenyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c(NS(=O)(=O)c2ccccc2)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN2O4S/c18-12-8-6-11(7-9-12)14-10-15(19-16(14)17(21)22)20-25(23,24)13-4-2-1-3-5-13/h1-10,19-20H,(H,21,22) |
| InChIKey | JPNCHLILBASSHI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |