C42H59NO3PS+ — CID 135387768
[2-(2-aminophenyl)phenyl]-ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphanium;methanesulfonic acid (PubChem CID 135387768) has the molecular formula C42H59NO3PS+ and a molecular weight of 688.98 g/mol. Its IUPAC name is [2-(2-aminophenyl)phenyl]-ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphanium;methanesulfonic acid.
| Compound Name | [2-(2-aminophenyl)phenyl]-ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphanium;methanesulfonic acid |
|---|---|
| PubChem CID | 135387768 |
| Molecular Formula | C42H59NO3PS+ |
| Molecular Weight | 688.98 g/mol |
| Exact Mass | 688.39 |
| IUPAC Name | [2-(2-aminophenyl)phenyl]-ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphanium;methanesulfonic acid |
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccccc2[P+](c2ccccc2-c2ccccc2N)(C(C)(C)C)C(C)(C)C)c(C(C)C)c1.CS(=O)(=O)O |
| InChI | InChI=1S/C41H55NP.CH4O3S/c1-27(2)30-25-34(28(3)4)39(35(26-30)29(5)6)33-21-15-18-24-38(33)43(40(7,8)9,41(10,11)12)37-23-17-14-20-32(37)31-19-13-16-22-36(31)42;1-5(2,3)4/h13-29H,42H2,1-12H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | AMTJMKNXSYXROH-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.98 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|