C7H8ClFN2O3 — CID 135388530
4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl chloride (PubChem CID 135388530) has the molecular formula C7H8ClFN2O3 and a molecular weight of 222.60 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl chloride.
| Compound Name | 4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl chloride |
|---|---|
| PubChem CID | 135388530 |
| Molecular Formula | C7H8ClFN2O3 |
| Molecular Weight | 222.60 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 4-(2-fluoroethyl)-2,3-dioxopiperazine-1-carbonyl chloride |
| SMILES | O=C1C(=O)N(C(=O)Cl)CCN1CCF |
| InChI | InChI=1S/C7H8ClFN2O3/c8-7(14)11-4-3-10(2-1-9)5(12)6(11)13/h1-4H2 |
| InChIKey | WCZXPHQISLUWQJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.60 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|