C7H10F2N2O2 — CID 126992728
1-(2,2-difluoroethyl)-4-methylpiperazine-2,6-dione (PubChem CID 126992728) has the molecular formula C7H10F2N2O2 and a molecular weight of 192.16 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-methylpiperazine-2,6-dione.
| Compound Name | 1-(2,2-difluoroethyl)-4-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 126992728 |
| Molecular Formula | C7H10F2N2O2 |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-methylpiperazine-2,6-dione |
| SMILES | CN1CC(=O)N(CC(F)F)C(=O)C1 |
| InChI | InChI=1S/C7H10F2N2O2/c1-10-3-6(12)11(2-5(8)9)7(13)4-10/h5H,2-4H2,1H3 |
| InChIKey | FLFGNBQJQDRWTE-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|