C7H15FO7P2 — CID 135389665
[2-[(1R,3S)-3-fluorocyclopentyl]-1-hydroxy-1-phosphonoethyl]phosphonic acid (PubChem CID 135389665) has the molecular formula C7H15FO7P2 and a molecular weight of 292.14 g/mol. Its IUPAC name is [2-[(1R,3S)-3-fluorocyclopentyl]-1-hydroxy-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[(1R,3S)-3-fluorocyclopentyl]-1-hydroxy-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 135389665 |
| Molecular Formula | C7H15FO7P2 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | [2-[(1R,3S)-3-fluorocyclopentyl]-1-hydroxy-1-phosphonoethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(O)(C[C@@H]1CC[C@H](F)C1)P(=O)(O)O |
| InChI | InChI=1S/C7H15FO7P2/c8-6-2-1-5(3-6)4-7(9,16(10,11)12)17(13,14)15/h5-6,9H,1-4H2,(H2,10,11,12)(H2,13,14,15)/t5-,6+/m1/s1 |
| InChIKey | OFYMHEOTPGSMRK-RITPCOANSA-N |
| XLogP | 0.52 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|