C10H22O7P2S — CID 54487047
[1-hydroxy-1-phosphono-2-[2-(3-sulfanylpropyl)cyclopentyl]ethyl]phosphonic acid (PubChem CID 54487047) has the molecular formula C10H22O7P2S and a molecular weight of 348.29 g/mol. Its IUPAC name is [1-hydroxy-1-phosphono-2-[2-(3-sulfanylpropyl)cyclopentyl]ethyl]phosphonic acid.
| Compound Name | [1-hydroxy-1-phosphono-2-[2-(3-sulfanylpropyl)cyclopentyl]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 54487047 |
| Molecular Formula | C10H22O7P2S |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [1-hydroxy-1-phosphono-2-[2-(3-sulfanylpropyl)cyclopentyl]ethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(O)(CC1CCCC1CCCS)P(=O)(O)O |
| InChI | InChI=1S/C10H22O7P2S/c11-10(18(12,13)14,19(15,16)17)7-9-4-1-3-8(9)5-2-6-20/h8-9,11,20H,1-7H2,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | XTBCUKWPJIYSED-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|