C16H26O7 — CID 67586810
6-[(1R,2R)-2-(4-carboxy-4,4-dihydroxybutyl)cyclopentyl]-4-oxohexanoic acid (PubChem CID 67586810) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is 6-[(1R,2R)-2-(4-carboxy-4,4-dihydroxybutyl)cyclopentyl]-4-oxohexanoic acid.
| Compound Name | 6-[(1R,2R)-2-(4-carboxy-4,4-dihydroxybutyl)cyclopentyl]-4-oxohexanoic acid |
|---|---|
| PubChem CID | 67586810 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 6-[(1R,2R)-2-(4-carboxy-4,4-dihydroxybutyl)cyclopentyl]-4-oxohexanoic acid |
| SMILES | O=C(O)CCC(=O)CC[C@H]1CCC[C@@H]1CCCC(O)(O)C(=O)O |
| InChI | InChI=1S/C16H26O7/c17-13(8-9-14(18)19)7-6-12-4-1-3-11(12)5-2-10-16(22,23)15(20)21/h11-12,22-23H,1-10H2,(H,18,19)(H,20,21)/t11-,12-/m1/s1 |
| InChIKey | WGKPLVCNFCFPOL-VXGBXAGGSA-N |
| XLogP | 1.55 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|