C11H8N4O — CID 135391320
3-butanoylcyclopropane-1,1,2,2-tetracarbonitrile (PubChem CID 135391320) has the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-butanoylcyclopropane-1,1,2,2-tetracarbonitrile.
| Compound Name | 3-butanoylcyclopropane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 135391320 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-butanoylcyclopropane-1,1,2,2-tetracarbonitrile |
| SMILES | CCCC(=O)C1C(C#N)(C#N)C1(C#N)C#N |
| InChI | InChI=1S/C11H8N4O/c1-2-3-8(16)9-10(4-12,5-13)11(9,6-14)7-15/h9H,2-3H2,1H3 |
| InChIKey | CHEZJJGRDQMGDH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 112.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|