C20H22BrFO3 — CID 135391614
1-(5-bromo-2-fluorophenyl)-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one (PubChem CID 135391614) has the molecular formula C20H22BrFO3 and a molecular weight of 409.30 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
|---|---|
| PubChem CID | 135391614 |
| Molecular Formula | C20H22BrFO3 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-7-(4-hydroxy-3-methoxyphenyl)heptan-3-one |
| SMILES | COc1cc(CCCCC(=O)CCc2cc(Br)ccc2F)ccc1O |
| InChI | InChI=1S/C20H22BrFO3/c1-25-20-12-14(6-11-19(20)24)4-2-3-5-17(23)9-7-15-13-16(21)8-10-18(15)22/h6,8,10-13,24H,2-5,7,9H2,1H3 |
| InChIKey | LWQGTMICMRCDNM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|