C17H19NO — CID 135395681
(4S)-4-(2,2-diphenylethyl)-1,3-oxazolidine (PubChem CID 135395681) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (4S)-4-(2,2-diphenylethyl)-1,3-oxazolidine.
| Compound Name | (4S)-4-(2,2-diphenylethyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 135395681 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (4S)-4-(2,2-diphenylethyl)-1,3-oxazolidine |
| SMILES | c1ccc(C(C[C@H]2COCN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO/c1-3-7-14(8-4-1)17(11-16-12-19-13-18-16)15-9-5-2-6-10-15/h1-10,16-18H,11-13H2/t16-/m0/s1 |
| InChIKey | ZCGFQLAWFKUINY-INIZCTEOSA-N |
| XLogP | 3.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |