About 2-phosphoroso-1H-indole
2-phosphoroso-1H-indole (PubChem CID 135398151) has the molecular formula C8H6NOP
and a molecular weight of 163.12 g/mol. Its IUPAC name is 2-phosphoroso-1H-indole.
Molecular Properties
| Compound Name | 2-phosphoroso-1H-indole |
| PubChem CID | 135398151 |
| Molecular Formula | C8H6NOP |
| Molecular Weight | 163.12 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | 2-phosphoroso-1H-indole |
| SMILES | O=Pc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C8H6NOP/c10-11-8-5-6-3-1-2-4-7(6)9-8/h1-5,9H |
| InChIKey | HFGCGQHHSQPOTO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.12 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-phosphoroso-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phosphoroso-1H-indole?
The IUPAC name of 2-phosphoroso-1H-indole (CID 135398151) is 2-phosphoroso-1H-indole.
What is the SMILES notation for 2-phosphoroso-1H-indole?
The canonical SMILES for 2-phosphoroso-1H-indole is O=Pc1cc2ccccc2[nH]1.
What is the InChIKey of 2-phosphoroso-1H-indole?
The InChIKey is HFGCGQHHSQPOTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6NOP/c10-11-8-5-6-3-1-2-4-7(6)9-8/h1-5,9H.
What are the key properties of 2-phosphoroso-1H-indole?
2-phosphoroso-1H-indole has a molecular weight of 163.12 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phosphoroso-1H-indole is sourced from PubChem (CID 135398151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).