C22H23F6N — CID 135398356
N,N-dimethyl-6,6-bis[3-(trifluoromethyl)phenyl]hex-5-en-1-amine (PubChem CID 135398356) has the molecular formula C22H23F6N and a molecular weight of 415.42 g/mol. Its IUPAC name is N,N-dimethyl-6,6-bis[3-(trifluoromethyl)phenyl]hex-5-en-1-amine.
| Compound Name | N,N-dimethyl-6,6-bis[3-(trifluoromethyl)phenyl]hex-5-en-1-amine |
|---|---|
| PubChem CID | 135398356 |
| Molecular Formula | C22H23F6N |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N,N-dimethyl-6,6-bis[3-(trifluoromethyl)phenyl]hex-5-en-1-amine |
| SMILES | CN(C)CCCCC=C(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F6N/c1-29(2)13-5-3-4-12-20(16-8-6-10-18(14-16)21(23,24)25)17-9-7-11-19(15-17)22(26,27)28/h6-12,14-15H,3-5,13H2,1-2H3 |
| InChIKey | SAFUFBMMPQWYIK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|