C24H31F3N2O2 — CID 14405526
N-[4-(dimethylamino)butyl]-N-[2-(2-methylpropoxy)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 14405526) has the molecular formula C24H31F3N2O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is N-[4-(dimethylamino)butyl]-N-[2-(2-methylpropoxy)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(dimethylamino)butyl]-N-[2-(2-methylpropoxy)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 14405526 |
| Molecular Formula | C24H31F3N2O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N-[4-(dimethylamino)butyl]-N-[2-(2-methylpropoxy)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CC(C)COc1ccccc1N(CCCCN(C)C)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H31F3N2O2/c1-18(2)17-31-22-13-6-5-12-21(22)29(15-8-7-14-28(3)4)23(30)19-10-9-11-20(16-19)24(25,26)27/h5-6,9-13,16,18H,7-8,14-15,17H2,1-4H3 |
| InChIKey | GCMXHOMSKIXIMB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|