C27H34Cl2N2O6 — CID 67931454
but-2-enedioic acid;2,5-dichloro-N-[4-(dimethylamino)butyl]-N-[2-(2-methylpropoxy)phenyl]benzamide (PubChem CID 67931454) has the molecular formula C27H34Cl2N2O6 and a molecular weight of 553.48 g/mol. Its IUPAC name is but-2-enedioic acid;2,5-dichloro-N-[4-(dimethylamino)butyl]-N-[2-(2-methylpropoxy)phenyl]benzamide.
| Compound Name | but-2-enedioic acid;2,5-dichloro-N-[4-(dimethylamino)butyl]-N-[2-(2-methylpropoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 67931454 |
| Molecular Formula | C27H34Cl2N2O6 |
| Molecular Weight | 553.48 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | but-2-enedioic acid;2,5-dichloro-N-[4-(dimethylamino)butyl]-N-[2-(2-methylpropoxy)phenyl]benzamide |
| SMILES | CC(C)COc1ccccc1N(CCCCN(C)C)C(=O)c1cc(Cl)ccc1Cl.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H30Cl2N2O2.C4H4O4/c1-17(2)16-29-22-10-6-5-9-21(22)27(14-8-7-13-26(3)4)23(28)19-15-18(24)11-12-20(19)25;5-3(6)1-2-4(7)8/h5-6,9-12,15,17H,7-8,13-14,16H2,1-4H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | UWLLEFKFYUPPFD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|