C10H10F3NS — CID 147361423
N,N-dimethyl-3-(trifluoromethyl)benzenecarbothioamide (PubChem CID 147361423) has the molecular formula C10H10F3NS and a molecular weight of 233.26 g/mol. Its IUPAC name is N,N-dimethyl-3-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | N,N-dimethyl-3-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 147361423 |
| Molecular Formula | C10H10F3NS |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | N,N-dimethyl-3-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CN(C)C(=S)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3NS/c1-14(2)9(15)7-4-3-5-8(6-7)10(11,12)13/h3-6H,1-2H3 |
| InChIKey | DHIOXUZNPIPBGQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|