C12H19NS — CID 143449435
ethane;N,N,3-trimethylbenzenecarbothioamide (PubChem CID 143449435) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is ethane;N,N,3-trimethylbenzenecarbothioamide.
| Compound Name | ethane;N,N,3-trimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 143449435 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | ethane;N,N,3-trimethylbenzenecarbothioamide |
| SMILES | CC.Cc1cccc(C(=S)N(C)C)c1 |
| InChI | InChI=1S/C10H13NS.C2H6/c1-8-5-4-6-9(7-8)10(12)11(2)3;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | QIVWNEUAPABFEK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|