C13H19NS — CID 23333039
N,N-dimethyl-3-(2-methylpropyl)benzenecarbothioamide (PubChem CID 23333039) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-methylpropyl)benzenecarbothioamide.
| Compound Name | N,N-dimethyl-3-(2-methylpropyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 23333039 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N,N-dimethyl-3-(2-methylpropyl)benzenecarbothioamide |
| SMILES | CC(C)Cc1cccc(C(=S)N(C)C)c1 |
| InChI | InChI=1S/C13H19NS/c1-10(2)8-11-6-5-7-12(9-11)13(15)14(3)4/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | KOUNYAFLJRDDLS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|