C13H25N3 — CID 143051619
N-amino-N,3-dimethylbenzenecarboximidamide;ethane (PubChem CID 143051619) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N-amino-N,3-dimethylbenzenecarboximidamide;ethane.
| Compound Name | N-amino-N,3-dimethylbenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 143051619 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N-amino-N,3-dimethylbenzenecarboximidamide;ethane |
| SMILES | CC.CC.[H]/N=C(/c1cccc(C)c1)N(C)N |
| InChI | InChI=1S/C9H13N3.2C2H6/c1-7-4-3-5-8(6-7)9(10)12(2)11;2*1-2/h3-6,10H,11H2,1-2H3;2*1-2H3/b10-9-;; |
| InChIKey | LEZGGCFJTAGKOR-XXAVUKJNSA-N |
| XLogP | 3.18 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|