C12H18N2O3 — CID 135399635
tert-butyl (8S)-1-hydroxy-3-imino-5,6,7,8-tetrahydropyrrolizine-2-carboxylate (PubChem CID 135399635) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is tert-butyl (8S)-1-hydroxy-3-imino-5,6,7,8-tetrahydropyrrolizine-2-carboxylate.
| Compound Name | tert-butyl (8S)-1-hydroxy-3-imino-5,6,7,8-tetrahydropyrrolizine-2-carboxylate |
|---|---|
| PubChem CID | 135399635 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | tert-butyl (8S)-1-hydroxy-3-imino-5,6,7,8-tetrahydropyrrolizine-2-carboxylate |
| SMILES | [H]/N=C1/C(C(=O)OC(C)(C)C)=C(O)[C@@H]2CCCN12 |
| InChI | InChI=1S/C12H18N2O3/c1-12(2,3)17-11(16)8-9(15)7-5-4-6-14(7)10(8)13/h7,13,15H,4-6H2,1-3H3/b13-10-/t7-/m0/s1 |
| InChIKey | FDXWNLLRAHVSNR-NUDOKVQDSA-N |
| XLogP | 1.60 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|