C30H53N5O4S — CID 160704313
tert-butyl 4-(2-iminopiperidin-1-yl)piperidine-1-carboxylate;tert-butyl 4-(2-sulfanylidenepiperidin-1-yl)piperidine-1-carboxylate (PubChem CID 160704313) has the molecular formula C30H53N5O4S and a molecular weight of 579.85 g/mol. Its IUPAC name is tert-butyl 4-(2-iminopiperidin-1-yl)piperidine-1-carboxylate;tert-butyl 4-(2-sulfanylidenepiperidin-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-iminopiperidin-1-yl)piperidine-1-carboxylate;tert-butyl 4-(2-sulfanylidenepiperidin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160704313 |
| Molecular Formula | C30H53N5O4S |
| Molecular Weight | 579.85 g/mol |
| Exact Mass | 579.38 |
| IUPAC Name | tert-butyl 4-(2-iminopiperidin-1-yl)piperidine-1-carboxylate;tert-butyl 4-(2-sulfanylidenepiperidin-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCCCC2=S)CC1.[H]/N=C1\CCCCN1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H27N3O2.C15H26N2O2S/c1-15(2,3)20-14(19)17-10-7-12(8-11-17)18-9-5-4-6-13(18)16;1-15(2,3)19-14(18)16-10-7-12(8-11-16)17-9-5-4-6-13(17)20/h12,16H,4-11H2,1-3H3;12H,4-11H2,1-3H3/b16-13+; |
| InChIKey | RRAHBUPSVCOWLA-ZUQRMPMESA-N |
| XLogP | 6.05 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|